C18H18N8O6S — CID 121072515
4-[4-(4-methyl-3,5-dinitrophenyl)sulfonylpiperazin-1-yl]-6-pyrazol-1-ylpyrimidine (PubChem CID 121072515) has the molecular formula C18H18N8O6S and a molecular weight of 474.46 g/mol. Its IUPAC name is 4-[4-(4-methyl-3,5-dinitrophenyl)sulfonylpiperazin-1-yl]-6-pyrazol-1-ylpyrimidine.
| Compound Name | 4-[4-(4-methyl-3,5-dinitrophenyl)sulfonylpiperazin-1-yl]-6-pyrazol-1-ylpyrimidine |
|---|---|
| PubChem CID | 121072515 |
| Molecular Formula | C18H18N8O6S |
| Molecular Weight | 474.46 g/mol |
| Exact Mass | 474.11 |
| IUPAC Name | 4-[4-(4-methyl-3,5-dinitrophenyl)sulfonylpiperazin-1-yl]-6-pyrazol-1-ylpyrimidine |
| SMILES | Cc1c([N+](=O)[O-])cc(S(=O)(=O)N2CCN(c3cc(-n4cccn4)ncn3)CC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H18N8O6S/c1-13-15(25(27)28)9-14(10-16(13)26(29)30)33(31,32)23-7-5-22(6-8-23)17-11-18(20-12-19-17)24-4-2-3-21-24/h2-4,9-12H,5-8H2,1H3 |
| InChIKey | LMDPTMIJKIXRLM-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 170.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.46 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|