C18H19ClN6O2S — CID 122337415
4-[4-(3-chloro-4-methylphenyl)sulfonylpiperazin-1-yl]-6-pyrazol-1-ylpyrimidine (PubChem CID 122337415) has the molecular formula C18H19ClN6O2S and a molecular weight of 418.91 g/mol. Its IUPAC name is 4-[4-(3-chloro-4-methylphenyl)sulfonylpiperazin-1-yl]-6-pyrazol-1-ylpyrimidine.
| Compound Name | 4-[4-(3-chloro-4-methylphenyl)sulfonylpiperazin-1-yl]-6-pyrazol-1-ylpyrimidine |
|---|---|
| PubChem CID | 122337415 |
| Molecular Formula | C18H19ClN6O2S |
| Molecular Weight | 418.91 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | 4-[4-(3-chloro-4-methylphenyl)sulfonylpiperazin-1-yl]-6-pyrazol-1-ylpyrimidine |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(c3cc(-n4cccn4)ncn3)CC2)cc1Cl |
| InChI | InChI=1S/C18H19ClN6O2S/c1-14-3-4-15(11-16(14)19)28(26,27)24-9-7-23(8-10-24)17-12-18(21-13-20-17)25-6-2-5-22-25/h2-6,11-13H,7-10H2,1H3 |
| InChIKey | WTMFYAUGWYZZEC-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 84.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.91 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |