C17H20N6O2S2 — CID 122337353
4-[4-(5-ethylthiophen-2-yl)sulfonylpiperazin-1-yl]-6-pyrazol-1-ylpyrimidine (PubChem CID 122337353) has the molecular formula C17H20N6O2S2 and a molecular weight of 404.52 g/mol. Its IUPAC name is 4-[4-(5-ethylthiophen-2-yl)sulfonylpiperazin-1-yl]-6-pyrazol-1-ylpyrimidine.
| Compound Name | 4-[4-(5-ethylthiophen-2-yl)sulfonylpiperazin-1-yl]-6-pyrazol-1-ylpyrimidine |
|---|---|
| PubChem CID | 122337353 |
| Molecular Formula | C17H20N6O2S2 |
| Molecular Weight | 404.52 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | 4-[4-(5-ethylthiophen-2-yl)sulfonylpiperazin-1-yl]-6-pyrazol-1-ylpyrimidine |
| SMILES | CCc1ccc(S(=O)(=O)N2CCN(c3cc(-n4cccn4)ncn3)CC2)s1 |
| InChI | InChI=1S/C17H20N6O2S2/c1-2-14-4-5-17(26-14)27(24,25)22-10-8-21(9-11-22)15-12-16(19-13-18-15)23-7-3-6-20-23/h3-7,12-13H,2,8-11H2,1H3 |
| InChIKey | XMRIAPNDSJFZGS-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 84.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.52 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |