C17H22N2O2S2 — CID 113075282
1-(5-ethylthiophen-2-yl)sulfonyl-4-(3-methylphenyl)piperazine (PubChem CID 113075282) has the molecular formula C17H22N2O2S2 and a molecular weight of 350.51 g/mol. Its IUPAC name is 1-(5-ethylthiophen-2-yl)sulfonyl-4-(3-methylphenyl)piperazine.
| Compound Name | 1-(5-ethylthiophen-2-yl)sulfonyl-4-(3-methylphenyl)piperazine |
|---|---|
| PubChem CID | 113075282 |
| Molecular Formula | C17H22N2O2S2 |
| Molecular Weight | 350.51 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | 1-(5-ethylthiophen-2-yl)sulfonyl-4-(3-methylphenyl)piperazine |
| SMILES | CCc1ccc(S(=O)(=O)N2CCN(c3cccc(C)c3)CC2)s1 |
| InChI | InChI=1S/C17H22N2O2S2/c1-3-16-7-8-17(22-16)23(20,21)19-11-9-18(10-12-19)15-6-4-5-14(2)13-15/h4-8,13H,3,9-12H2,1-2H3 |
| InChIKey | FNHVZVHNFOVPIW-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.51 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |