C17H21ClN2O2S2 — CID 113076892
1-(3-chloro-4-methylphenyl)-4-(5-ethylthiophen-2-yl)sulfonylpiperazine (PubChem CID 113076892) has the molecular formula C17H21ClN2O2S2 and a molecular weight of 384.95 g/mol. Its IUPAC name is 1-(3-chloro-4-methylphenyl)-4-(5-ethylthiophen-2-yl)sulfonylpiperazine.
| Compound Name | 1-(3-chloro-4-methylphenyl)-4-(5-ethylthiophen-2-yl)sulfonylpiperazine |
|---|---|
| PubChem CID | 113076892 |
| Molecular Formula | C17H21ClN2O2S2 |
| Molecular Weight | 384.95 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | 1-(3-chloro-4-methylphenyl)-4-(5-ethylthiophen-2-yl)sulfonylpiperazine |
| SMILES | CCc1ccc(S(=O)(=O)N2CCN(c3ccc(C)c(Cl)c3)CC2)s1 |
| InChI | InChI=1S/C17H21ClN2O2S2/c1-3-15-6-7-17(23-15)24(21,22)20-10-8-19(9-11-20)14-5-4-13(2)16(18)12-14/h4-7,12H,3,8-11H2,1-2H3 |
| InChIKey | DJBGHJUHZRBKHU-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.95 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |