C16H19ClN2O2S2 — CID 113076664
1-(3-chlorophenyl)-4-(5-ethylthiophen-2-yl)sulfonylpiperazine (PubChem CID 113076664) has the molecular formula C16H19ClN2O2S2 and a molecular weight of 370.93 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-4-(5-ethylthiophen-2-yl)sulfonylpiperazine.
| Compound Name | 1-(3-chlorophenyl)-4-(5-ethylthiophen-2-yl)sulfonylpiperazine |
|---|---|
| PubChem CID | 113076664 |
| Molecular Formula | C16H19ClN2O2S2 |
| Molecular Weight | 370.93 g/mol |
| Exact Mass | 370.06 |
| IUPAC Name | 1-(3-chlorophenyl)-4-(5-ethylthiophen-2-yl)sulfonylpiperazine |
| SMILES | CCc1ccc(S(=O)(=O)N2CCN(c3cccc(Cl)c3)CC2)s1 |
| InChI | InChI=1S/C16H19ClN2O2S2/c1-2-15-6-7-16(22-15)23(20,21)19-10-8-18(9-11-19)14-5-3-4-13(17)12-14/h3-7,12H,2,8-11H2,1H3 |
| InChIKey | YDGQXEPVBIGQGL-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.93 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |