C18H19ClN4O2S2 — CID 20947441
1-(3-chlorophenyl)-4-[5-(5-methyl-1H-pyrazol-3-yl)thiophen-2-yl]sulfonylpiperazine (PubChem CID 20947441) has the molecular formula C18H19ClN4O2S2 and a molecular weight of 422.96 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-4-[5-(5-methyl-1H-pyrazol-3-yl)thiophen-2-yl]sulfonylpiperazine.
| Compound Name | 1-(3-chlorophenyl)-4-[5-(5-methyl-1H-pyrazol-3-yl)thiophen-2-yl]sulfonylpiperazine |
|---|---|
| PubChem CID | 20947441 |
| Molecular Formula | C18H19ClN4O2S2 |
| Molecular Weight | 422.96 g/mol |
| Exact Mass | 422.06 |
| IUPAC Name | 1-(3-chlorophenyl)-4-[5-(5-methyl-1H-pyrazol-3-yl)thiophen-2-yl]sulfonylpiperazine |
| SMILES | Cc1cc(-c2ccc(S(=O)(=O)N3CCN(c4cccc(Cl)c4)CC3)s2)n[nH]1 |
| InChI | InChI=1S/C18H19ClN4O2S2/c1-13-11-16(21-20-13)17-5-6-18(26-17)27(24,25)23-9-7-22(8-10-23)15-4-2-3-14(19)12-15/h2-6,11-12H,7-10H2,1H3,(H,20,21) |
| InChIKey | MDKNDDRGXVGCII-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.96 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |