C12H15N3O3S2 — CID 20947492
4-[5-(5-methyl-1H-pyrazol-3-yl)thiophen-2-yl]sulfonylmorpholine (PubChem CID 20947492) has the molecular formula C12H15N3O3S2 and a molecular weight of 313.40 g/mol. Its IUPAC name is 4-[5-(5-methyl-1H-pyrazol-3-yl)thiophen-2-yl]sulfonylmorpholine.
| Compound Name | 4-[5-(5-methyl-1H-pyrazol-3-yl)thiophen-2-yl]sulfonylmorpholine |
|---|---|
| PubChem CID | 20947492 |
| Molecular Formula | C12H15N3O3S2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | 4-[5-(5-methyl-1H-pyrazol-3-yl)thiophen-2-yl]sulfonylmorpholine |
| SMILES | Cc1cc(-c2ccc(S(=O)(=O)N3CCOCC3)s2)n[nH]1 |
| InChI | InChI=1S/C12H15N3O3S2/c1-9-8-10(14-13-9)11-2-3-12(19-11)20(16,17)15-4-6-18-7-5-15/h2-3,8H,4-7H2,1H3,(H,13,14) |
| InChIKey | SWKZZAGPQSYOTP-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |