C15H18BrN3O3S2 — CID 133373307
5-bromo-3-methyl-N-[(5-morpholin-4-ylsulfonylthiophen-2-yl)methyl]pyridin-2-amine (PubChem CID 133373307) has the molecular formula C15H18BrN3O3S2 and a molecular weight of 432.37 g/mol. Its IUPAC name is 5-bromo-3-methyl-N-[(5-morpholin-4-ylsulfonylthiophen-2-yl)methyl]pyridin-2-amine.
| Compound Name | 5-bromo-3-methyl-N-[(5-morpholin-4-ylsulfonylthiophen-2-yl)methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 133373307 |
| Molecular Formula | C15H18BrN3O3S2 |
| Molecular Weight | 432.37 g/mol |
| Exact Mass | 431.00 |
| IUPAC Name | 5-bromo-3-methyl-N-[(5-morpholin-4-ylsulfonylthiophen-2-yl)methyl]pyridin-2-amine |
| SMILES | Cc1cc(Br)cnc1NCc1ccc(S(=O)(=O)N2CCOCC2)s1 |
| InChI | InChI=1S/C15H18BrN3O3S2/c1-11-8-12(16)9-17-15(11)18-10-13-2-3-14(23-13)24(20,21)19-4-6-22-7-5-19/h2-3,8-9H,4-7,10H2,1H3,(H,17,18) |
| InChIKey | FJLVICFYCYNHAM-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.37 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |