C18H22BrN3O2S — CID 133373024
5-bromo-3-methyl-N-[(4-piperidin-1-ylsulfonylphenyl)methyl]pyridin-2-amine (PubChem CID 133373024) has the molecular formula C18H22BrN3O2S and a molecular weight of 424.36 g/mol. Its IUPAC name is 5-bromo-3-methyl-N-[(4-piperidin-1-ylsulfonylphenyl)methyl]pyridin-2-amine.
| Compound Name | 5-bromo-3-methyl-N-[(4-piperidin-1-ylsulfonylphenyl)methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 133373024 |
| Molecular Formula | C18H22BrN3O2S |
| Molecular Weight | 424.36 g/mol |
| Exact Mass | 423.06 |
| IUPAC Name | 5-bromo-3-methyl-N-[(4-piperidin-1-ylsulfonylphenyl)methyl]pyridin-2-amine |
| SMILES | Cc1cc(Br)cnc1NCc1ccc(S(=O)(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C18H22BrN3O2S/c1-14-11-16(19)13-21-18(14)20-12-15-5-7-17(8-6-15)25(23,24)22-9-3-2-4-10-22/h5-8,11,13H,2-4,9-10,12H2,1H3,(H,20,21) |
| InChIKey | FNGHRMXLEHNPEZ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.36 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |