C18H20F3N3O2S — CID 133358464
N-[(4-piperidin-1-ylsulfonylphenyl)methyl]-4-(trifluoromethyl)pyridin-2-amine (PubChem CID 133358464) has the molecular formula C18H20F3N3O2S and a molecular weight of 399.44 g/mol. Its IUPAC name is N-[(4-piperidin-1-ylsulfonylphenyl)methyl]-4-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-[(4-piperidin-1-ylsulfonylphenyl)methyl]-4-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 133358464 |
| Molecular Formula | C18H20F3N3O2S |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | N-[(4-piperidin-1-ylsulfonylphenyl)methyl]-4-(trifluoromethyl)pyridin-2-amine |
| SMILES | O=S(=O)(c1ccc(CNc2cc(C(F)(F)F)ccn2)cc1)N1CCCCC1 |
| InChI | InChI=1S/C18H20F3N3O2S/c19-18(20,21)15-8-9-22-17(12-15)23-13-14-4-6-16(7-5-14)27(25,26)24-10-2-1-3-11-24/h4-9,12H,1-3,10-11,13H2,(H,22,23) |
| InChIKey | YXYLWXJXGPDVMI-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |