C17H15F3N4 — CID 133359241
N-[[4-(imidazol-1-ylmethyl)phenyl]methyl]-4-(trifluoromethyl)pyridin-2-amine (PubChem CID 133359241) has the molecular formula C17H15F3N4 and a molecular weight of 332.33 g/mol. Its IUPAC name is N-[[4-(imidazol-1-ylmethyl)phenyl]methyl]-4-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-[[4-(imidazol-1-ylmethyl)phenyl]methyl]-4-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 133359241 |
| Molecular Formula | C17H15F3N4 |
| Molecular Weight | 332.33 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | N-[[4-(imidazol-1-ylmethyl)phenyl]methyl]-4-(trifluoromethyl)pyridin-2-amine |
| SMILES | FC(F)(F)c1ccnc(NCc2ccc(Cn3ccnc3)cc2)c1 |
| InChI | InChI=1S/C17H15F3N4/c18-17(19,20)15-5-6-22-16(9-15)23-10-13-1-3-14(4-2-13)11-24-8-7-21-12-24/h1-9,12H,10-11H2,(H,22,23) |
| InChIKey | NMJMSMBRZLRXNR-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.33 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |