C19H18F3N3O2S — CID 133374221
2-[(4-pyrrolidin-1-ylsulfonylphenyl)methylamino]-5-(trifluoromethyl)benzonitrile (PubChem CID 133374221) has the molecular formula C19H18F3N3O2S and a molecular weight of 409.43 g/mol. Its IUPAC name is 2-[(4-pyrrolidin-1-ylsulfonylphenyl)methylamino]-5-(trifluoromethyl)benzonitrile.
| Compound Name | 2-[(4-pyrrolidin-1-ylsulfonylphenyl)methylamino]-5-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 133374221 |
| Molecular Formula | C19H18F3N3O2S |
| Molecular Weight | 409.43 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | 2-[(4-pyrrolidin-1-ylsulfonylphenyl)methylamino]-5-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1cc(C(F)(F)F)ccc1NCc1ccc(S(=O)(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C19H18F3N3O2S/c20-19(21,22)16-5-8-18(15(11-16)12-23)24-13-14-3-6-17(7-4-14)28(26,27)25-9-1-2-10-25/h3-8,11,24H,1-2,9-10,13H2 |
| InChIKey | NVJWCGMCXOFHEE-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.43 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |