C18H20FN3O5S — CID 133374218
4-fluoro-5-methoxy-2-nitro-N-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]aniline (PubChem CID 133374218) has the molecular formula C18H20FN3O5S and a molecular weight of 409.44 g/mol. Its IUPAC name is 4-fluoro-5-methoxy-2-nitro-N-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]aniline.
| Compound Name | 4-fluoro-5-methoxy-2-nitro-N-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]aniline |
|---|---|
| PubChem CID | 133374218 |
| Molecular Formula | C18H20FN3O5S |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | 4-fluoro-5-methoxy-2-nitro-N-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]aniline |
| SMILES | COc1cc(NCc2ccc(S(=O)(=O)N3CCCC3)cc2)c([N+](=O)[O-])cc1F |
| InChI | InChI=1S/C18H20FN3O5S/c1-27-18-11-16(17(22(23)24)10-15(18)19)20-12-13-4-6-14(7-5-13)28(25,26)21-8-2-3-9-21/h4-7,10-11,20H,2-3,8-9,12H2,1H3 |
| InChIKey | JUALCUKQPIJRHI-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|