C19H23N3O7S — CID 18777948
3,4,5-trimethoxy-N-(2-nitro-4-pyrrolidin-1-ylsulfonylphenyl)aniline (PubChem CID 18777948) has the molecular formula C19H23N3O7S and a molecular weight of 437.47 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-(2-nitro-4-pyrrolidin-1-ylsulfonylphenyl)aniline.
| Compound Name | 3,4,5-trimethoxy-N-(2-nitro-4-pyrrolidin-1-ylsulfonylphenyl)aniline |
|---|---|
| PubChem CID | 18777948 |
| Molecular Formula | C19H23N3O7S |
| Molecular Weight | 437.47 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | 3,4,5-trimethoxy-N-(2-nitro-4-pyrrolidin-1-ylsulfonylphenyl)aniline |
| SMILES | COc1cc(Nc2ccc(S(=O)(=O)N3CCCC3)cc2[N+](=O)[O-])cc(OC)c1OC |
| InChI | InChI=1S/C19H23N3O7S/c1-27-17-10-13(11-18(28-2)19(17)29-3)20-15-7-6-14(12-16(15)22(23)24)30(25,26)21-8-4-5-9-21/h6-7,10-12,20H,4-5,8-9H2,1-3H3 |
| InChIKey | WKQAQZZIIBPQOA-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 120.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.47 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|