C13H17N3O5S — CID 14226695
N-(2-nitro-4-piperidin-1-ylsulfonylphenyl)acetamide (PubChem CID 14226695) has the molecular formula C13H17N3O5S and a molecular weight of 327.36 g/mol. Its IUPAC name is N-(2-nitro-4-piperidin-1-ylsulfonylphenyl)acetamide.
| Compound Name | N-(2-nitro-4-piperidin-1-ylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 14226695 |
| Molecular Formula | C13H17N3O5S |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | N-(2-nitro-4-piperidin-1-ylsulfonylphenyl)acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N2CCCCC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H17N3O5S/c1-10(17)14-12-6-5-11(9-13(12)16(18)19)22(20,21)15-7-3-2-4-8-15/h5-6,9H,2-4,7-8H2,1H3,(H,14,17) |
| InChIKey | VKTSEEQELWJKCY-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|