C19H20FN3O4 — CID 133373883
1-[[3-[(4-fluoro-5-methoxy-2-nitroanilino)methyl]phenyl]methyl]pyrrolidin-2-one (PubChem CID 133373883) has the molecular formula C19H20FN3O4 and a molecular weight of 373.38 g/mol. Its IUPAC name is 1-[[3-[(4-fluoro-5-methoxy-2-nitroanilino)methyl]phenyl]methyl]pyrrolidin-2-one.
| Compound Name | 1-[[3-[(4-fluoro-5-methoxy-2-nitroanilino)methyl]phenyl]methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 133373883 |
| Molecular Formula | C19H20FN3O4 |
| Molecular Weight | 373.38 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | 1-[[3-[(4-fluoro-5-methoxy-2-nitroanilino)methyl]phenyl]methyl]pyrrolidin-2-one |
| SMILES | COc1cc(NCc2cccc(CN3CCCC3=O)c2)c([N+](=O)[O-])cc1F |
| InChI | InChI=1S/C19H20FN3O4/c1-27-18-10-16(17(23(25)26)9-15(18)20)21-11-13-4-2-5-14(8-13)12-22-7-3-6-19(22)24/h2,4-5,8-10,21H,3,6-7,11-12H2,1H3 |
| InChIKey | JMQZRJTWFMYCQX-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.38 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|