C20H23N5O5 — CID 11304514
1-[3-[5-(benzylamino)-2,4-dinitroanilino]propyl]pyrrolidin-2-one (PubChem CID 11304514) has the molecular formula C20H23N5O5 and a molecular weight of 413.43 g/mol. Its IUPAC name is 1-[3-[5-(benzylamino)-2,4-dinitroanilino]propyl]pyrrolidin-2-one.
| Compound Name | 1-[3-[5-(benzylamino)-2,4-dinitroanilino]propyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 11304514 |
| Molecular Formula | C20H23N5O5 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | 1-[3-[5-(benzylamino)-2,4-dinitroanilino]propyl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1CCCNc1cc(NCc2ccccc2)c([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H23N5O5/c26-20-8-4-10-23(20)11-5-9-21-16-12-17(22-14-15-6-2-1-3-7-15)19(25(29)30)13-18(16)24(27)28/h1-3,6-7,12-13,21-22H,4-5,8-11,14H2 |
| InChIKey | ITSDFRZFXSHKBW-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 130.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|