C12H17N4O3+ — CID 8934038
1-[3-[(3-nitropyridin-1-ium-2-yl)amino]propyl]pyrrolidin-2-one (PubChem CID 8934038) has the molecular formula C12H17N4O3+ and a molecular weight of 265.29 g/mol. Its IUPAC name is 1-[3-[(3-nitropyridin-1-ium-2-yl)amino]propyl]pyrrolidin-2-one.
| Compound Name | 1-[3-[(3-nitropyridin-1-ium-2-yl)amino]propyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 8934038 |
| Molecular Formula | C12H17N4O3+ |
| Molecular Weight | 265.29 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 1-[3-[(3-nitropyridin-1-ium-2-yl)amino]propyl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1CCCNc1[nH+]cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H16N4O3/c17-11-5-2-8-15(11)9-3-7-14-12-10(16(18)19)4-1-6-13-12/h1,4,6H,2-3,5,7-9H2,(H,13,14)/p+1 |
| InChIKey | JMVIDIXCDUGPMT-UHFFFAOYSA-O |
| XLogP | 0.83 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.29 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|