C16H20N4O3S — CID 78809585
1-[3-[(6-nitro-1,3-benzothiazol-2-yl)amino]propyl]azepan-2-one (PubChem CID 78809585) has the molecular formula C16H20N4O3S and a molecular weight of 348.43 g/mol. Its IUPAC name is 1-[3-[(6-nitro-1,3-benzothiazol-2-yl)amino]propyl]azepan-2-one.
| Compound Name | 1-[3-[(6-nitro-1,3-benzothiazol-2-yl)amino]propyl]azepan-2-one |
|---|---|
| PubChem CID | 78809585 |
| Molecular Formula | C16H20N4O3S |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 1-[3-[(6-nitro-1,3-benzothiazol-2-yl)amino]propyl]azepan-2-one |
| SMILES | O=C1CCCCCN1CCCNc1nc2ccc([N+](=O)[O-])cc2s1 |
| InChI | InChI=1S/C16H20N4O3S/c21-15-5-2-1-3-9-19(15)10-4-8-17-16-18-13-7-6-12(20(22)23)11-14(13)24-16/h6-7,11H,1-5,8-10H2,(H,17,18) |
| InChIKey | AIVJRLKEPAQWFY-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 88.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|