C23H26N4O3S — CID 117090279
2-[3-(2-oxopyrrolidin-1-yl)propylamino]-N-(2-phenoxyethyl)-1,3-benzothiazole-6-carboxamide (PubChem CID 117090279) has the molecular formula C23H26N4O3S and a molecular weight of 438.55 g/mol. Its IUPAC name is 2-[3-(2-oxopyrrolidin-1-yl)propylamino]-N-(2-phenoxyethyl)-1,3-benzothiazole-6-carboxamide.
| Compound Name | 2-[3-(2-oxopyrrolidin-1-yl)propylamino]-N-(2-phenoxyethyl)-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 117090279 |
| Molecular Formula | C23H26N4O3S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | 2-[3-(2-oxopyrrolidin-1-yl)propylamino]-N-(2-phenoxyethyl)-1,3-benzothiazole-6-carboxamide |
| SMILES | O=C(NCCOc1ccccc1)c1ccc2nc(NCCCN3CCCC3=O)sc2c1 |
| InChI | InChI=1S/C23H26N4O3S/c28-21-8-4-13-27(21)14-5-11-25-23-26-19-10-9-17(16-20(19)31-23)22(29)24-12-15-30-18-6-2-1-3-7-18/h1-3,6-7,9-10,16H,4-5,8,11-15H2,(H,24,29)(H,25,26) |
| InChIKey | CCHTZMKBYMMXDH-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|