C23H26N4O3S — CID 117085815
N-[2-(4-hydroxyphenyl)ethyl]-2-[3-(2-oxopyrrolidin-1-yl)propylamino]-1,3-benzothiazole-6-carboxamide (PubChem CID 117085815) has the molecular formula C23H26N4O3S and a molecular weight of 438.55 g/mol. Its IUPAC name is N-[2-(4-hydroxyphenyl)ethyl]-2-[3-(2-oxopyrrolidin-1-yl)propylamino]-1,3-benzothiazole-6-carboxamide.
| Compound Name | N-[2-(4-hydroxyphenyl)ethyl]-2-[3-(2-oxopyrrolidin-1-yl)propylamino]-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 117085815 |
| Molecular Formula | C23H26N4O3S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | N-[2-(4-hydroxyphenyl)ethyl]-2-[3-(2-oxopyrrolidin-1-yl)propylamino]-1,3-benzothiazole-6-carboxamide |
| SMILES | O=C(NCCc1ccc(O)cc1)c1ccc2nc(NCCCN3CCCC3=O)sc2c1 |
| InChI | InChI=1S/C23H26N4O3S/c28-18-7-4-16(5-8-18)10-12-24-22(30)17-6-9-19-20(15-17)31-23(26-19)25-11-2-14-27-13-1-3-21(27)29/h4-9,15,28H,1-3,10-14H2,(H,24,30)(H,25,26) |
| InChIKey | UWEQOTYGRMEMRF-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|