C24H28N4O3S — CID 117094377
N-[2-(4-methoxyphenyl)ethyl]-2-[3-(2-oxopyrrolidin-1-yl)propylamino]-1,3-benzothiazole-6-carboxamide (PubChem CID 117094377) has the molecular formula C24H28N4O3S and a molecular weight of 452.58 g/mol. Its IUPAC name is N-[2-(4-methoxyphenyl)ethyl]-2-[3-(2-oxopyrrolidin-1-yl)propylamino]-1,3-benzothiazole-6-carboxamide.
| Compound Name | N-[2-(4-methoxyphenyl)ethyl]-2-[3-(2-oxopyrrolidin-1-yl)propylamino]-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 117094377 |
| Molecular Formula | C24H28N4O3S |
| Molecular Weight | 452.58 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | N-[2-(4-methoxyphenyl)ethyl]-2-[3-(2-oxopyrrolidin-1-yl)propylamino]-1,3-benzothiazole-6-carboxamide |
| SMILES | COc1ccc(CCNC(=O)c2ccc3nc(NCCCN4CCCC4=O)sc3c2)cc1 |
| InChI | InChI=1S/C24H28N4O3S/c1-31-19-8-5-17(6-9-19)11-13-25-23(30)18-7-10-20-21(16-18)32-24(27-20)26-12-3-15-28-14-2-4-22(28)29/h5-10,16H,2-4,11-15H2,1H3,(H,25,30)(H,26,27) |
| InChIKey | UIWMXSLJNBQRGB-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.58 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|