C27H33N5O2S — CID 117083071
2-[(1-benzylpiperidin-4-yl)amino]-N-[3-(2-oxopyrrolidin-1-yl)propyl]-1,3-benzothiazole-6-carboxamide (PubChem CID 117083071) has the molecular formula C27H33N5O2S and a molecular weight of 491.66 g/mol. Its IUPAC name is 2-[(1-benzylpiperidin-4-yl)amino]-N-[3-(2-oxopyrrolidin-1-yl)propyl]-1,3-benzothiazole-6-carboxamide.
| Compound Name | 2-[(1-benzylpiperidin-4-yl)amino]-N-[3-(2-oxopyrrolidin-1-yl)propyl]-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 117083071 |
| Molecular Formula | C27H33N5O2S |
| Molecular Weight | 491.66 g/mol |
| Exact Mass | 491.24 |
| IUPAC Name | 2-[(1-benzylpiperidin-4-yl)amino]-N-[3-(2-oxopyrrolidin-1-yl)propyl]-1,3-benzothiazole-6-carboxamide |
| SMILES | O=C(NCCCN1CCCC1=O)c1ccc2nc(NC3CCN(Cc4ccccc4)CC3)sc2c1 |
| InChI | InChI=1S/C27H33N5O2S/c33-25-8-4-14-32(25)15-5-13-28-26(34)21-9-10-23-24(18-21)35-27(30-23)29-22-11-16-31(17-12-22)19-20-6-2-1-3-7-20/h1-3,6-7,9-10,18,22H,4-5,8,11-17,19H2,(H,28,34)(H,29,30) |
| InChIKey | CZJRSWHGWFEASN-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.66 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|