C23H28N4OS — CID 117084306
2-[(1-benzylpiperidin-4-yl)amino]-N-propyl-1,3-benzothiazole-6-carboxamide (PubChem CID 117084306) has the molecular formula C23H28N4OS and a molecular weight of 408.57 g/mol. Its IUPAC name is 2-[(1-benzylpiperidin-4-yl)amino]-N-propyl-1,3-benzothiazole-6-carboxamide.
| Compound Name | 2-[(1-benzylpiperidin-4-yl)amino]-N-propyl-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 117084306 |
| Molecular Formula | C23H28N4OS |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 2-[(1-benzylpiperidin-4-yl)amino]-N-propyl-1,3-benzothiazole-6-carboxamide |
| SMILES | CCCNC(=O)c1ccc2nc(NC3CCN(Cc4ccccc4)CC3)sc2c1 |
| InChI | InChI=1S/C23H28N4OS/c1-2-12-24-22(28)18-8-9-20-21(15-18)29-23(26-20)25-19-10-13-27(14-11-19)16-17-6-4-3-5-7-17/h3-9,15,19H,2,10-14,16H2,1H3,(H,24,28)(H,25,26) |
| InChIKey | HSAMINCUDZQNQN-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |