C23H33N7O — CID 117087297
1-[3-[[2-amino-6-[(1-benzylpiperidin-4-yl)amino]pyrimidin-4-yl]amino]propyl]pyrrolidin-2-one (PubChem CID 117087297) has the molecular formula C23H33N7O and a molecular weight of 423.57 g/mol. Its IUPAC name is 1-[3-[[2-amino-6-[(1-benzylpiperidin-4-yl)amino]pyrimidin-4-yl]amino]propyl]pyrrolidin-2-one.
| Compound Name | 1-[3-[[2-amino-6-[(1-benzylpiperidin-4-yl)amino]pyrimidin-4-yl]amino]propyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 117087297 |
| Molecular Formula | C23H33N7O |
| Molecular Weight | 423.57 g/mol |
| Exact Mass | 423.27 |
| IUPAC Name | 1-[3-[[2-amino-6-[(1-benzylpiperidin-4-yl)amino]pyrimidin-4-yl]amino]propyl]pyrrolidin-2-one |
| SMILES | Nc1nc(NCCCN2CCCC2=O)cc(NC2CCN(Cc3ccccc3)CC2)n1 |
| InChI | InChI=1S/C23H33N7O/c24-23-27-20(25-11-5-13-30-12-4-8-22(30)31)16-21(28-23)26-19-9-14-29(15-10-19)17-18-6-2-1-3-7-18/h1-3,6-7,16,19H,4-5,8-15,17H2,(H4,24,25,26,27,28) |
| InChIKey | XUCCHNPPCXLBMN-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 99.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.57 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|