C18H22ClN3 — CID 22922520
2-N-(1-benzylpiperidin-4-yl)-4-chlorobenzene-1,2-diamine (PubChem CID 22922520) has the molecular formula C18H22ClN3 and a molecular weight of 315.85 g/mol. Its IUPAC name is 2-N-(1-benzylpiperidin-4-yl)-4-chlorobenzene-1,2-diamine.
| Compound Name | 2-N-(1-benzylpiperidin-4-yl)-4-chlorobenzene-1,2-diamine |
|---|---|
| PubChem CID | 22922520 |
| Molecular Formula | C18H22ClN3 |
| Molecular Weight | 315.85 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | 2-N-(1-benzylpiperidin-4-yl)-4-chlorobenzene-1,2-diamine |
| SMILES | Nc1ccc(Cl)cc1NC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C18H22ClN3/c19-15-6-7-17(20)18(12-15)21-16-8-10-22(11-9-16)13-14-4-2-1-3-5-14/h1-7,12,16,21H,8-11,13,20H2 |
| InChIKey | AOQISHZFOXZXJD-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.85 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|