C20H24ClN3S — CID 17264882
1-(1-benzylpiperidin-4-yl)-3-(5-chloro-2-methylphenyl)thiourea (PubChem CID 17264882) has the molecular formula C20H24ClN3S and a molecular weight of 373.95 g/mol. Its IUPAC name is 1-(1-benzylpiperidin-4-yl)-3-(5-chloro-2-methylphenyl)thiourea.
| Compound Name | 1-(1-benzylpiperidin-4-yl)-3-(5-chloro-2-methylphenyl)thiourea |
|---|---|
| PubChem CID | 17264882 |
| Molecular Formula | C20H24ClN3S |
| Molecular Weight | 373.95 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | 1-(1-benzylpiperidin-4-yl)-3-(5-chloro-2-methylphenyl)thiourea |
| SMILES | Cc1ccc(Cl)cc1NC(=S)NC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C20H24ClN3S/c1-15-7-8-17(21)13-19(15)23-20(25)22-18-9-11-24(12-10-18)14-16-5-3-2-4-6-16/h2-8,13,18H,9-12,14H2,1H3,(H2,22,23,25) |
| InChIKey | RNMVIPRUPLKBSF-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.95 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|