C19H20Cl3N3O — CID 23825400
1-(1-benzylpiperidin-4-yl)-3-(2,4,5-trichlorophenyl)urea (PubChem CID 23825400) has the molecular formula C19H20Cl3N3O and a molecular weight of 412.75 g/mol. Its IUPAC name is 1-(1-benzylpiperidin-4-yl)-3-(2,4,5-trichlorophenyl)urea.
| Compound Name | 1-(1-benzylpiperidin-4-yl)-3-(2,4,5-trichlorophenyl)urea |
|---|---|
| PubChem CID | 23825400 |
| Molecular Formula | C19H20Cl3N3O |
| Molecular Weight | 412.75 g/mol |
| Exact Mass | 411.07 |
| IUPAC Name | 1-(1-benzylpiperidin-4-yl)-3-(2,4,5-trichlorophenyl)urea |
| SMILES | O=C(Nc1cc(Cl)c(Cl)cc1Cl)NC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C19H20Cl3N3O/c20-15-10-17(22)18(11-16(15)21)24-19(26)23-14-6-8-25(9-7-14)12-13-4-2-1-3-5-13/h1-5,10-11,14H,6-9,12H2,(H2,23,24,26) |
| InChIKey | WGSKYLGMVFCYDE-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.75 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|