C16H19Cl3N4O2 — CID 99783586
2-[(3R)-3-(cyclopropylcarbamoylamino)pyrrolidin-1-yl]-N-(2,4,5-trichlorophenyl)acetamide (PubChem CID 99783586) has the molecular formula C16H19Cl3N4O2 and a molecular weight of 405.71 g/mol. Its IUPAC name is 2-[(3R)-3-(cyclopropylcarbamoylamino)pyrrolidin-1-yl]-N-(2,4,5-trichlorophenyl)acetamide.
| Compound Name | 2-[(3R)-3-(cyclopropylcarbamoylamino)pyrrolidin-1-yl]-N-(2,4,5-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 99783586 |
| Molecular Formula | C16H19Cl3N4O2 |
| Molecular Weight | 405.71 g/mol |
| Exact Mass | 404.06 |
| IUPAC Name | 2-[(3R)-3-(cyclopropylcarbamoylamino)pyrrolidin-1-yl]-N-(2,4,5-trichlorophenyl)acetamide |
| SMILES | O=C(CN1CC[C@@H](NC(=O)NC2CC2)C1)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C16H19Cl3N4O2/c17-11-5-13(19)14(6-12(11)18)22-15(24)8-23-4-3-10(7-23)21-16(25)20-9-1-2-9/h5-6,9-10H,1-4,7-8H2,(H,22,24)(H2,20,21,25)/t10-/m1/s1 |
| InChIKey | CTXACFPXCLQXMS-SNVBAGLBSA-N |
| XLogP | 3.12 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.71 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|