C15H20Cl3N3O — CID 119925484
2-[3-(1-aminoethyl)piperidin-1-yl]-N-(2,4,5-trichlorophenyl)acetamide (PubChem CID 119925484) has the molecular formula C15H20Cl3N3O and a molecular weight of 364.70 g/mol. Its IUPAC name is 2-[3-(1-aminoethyl)piperidin-1-yl]-N-(2,4,5-trichlorophenyl)acetamide.
| Compound Name | 2-[3-(1-aminoethyl)piperidin-1-yl]-N-(2,4,5-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 119925484 |
| Molecular Formula | C15H20Cl3N3O |
| Molecular Weight | 364.70 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | 2-[3-(1-aminoethyl)piperidin-1-yl]-N-(2,4,5-trichlorophenyl)acetamide |
| SMILES | CC(N)C1CCCN(CC(=O)Nc2cc(Cl)c(Cl)cc2Cl)C1 |
| InChI | InChI=1S/C15H20Cl3N3O/c1-9(19)10-3-2-4-21(7-10)8-15(22)20-14-6-12(17)11(16)5-13(14)18/h5-6,9-10H,2-4,7-8,19H2,1H3,(H,20,22) |
| InChIKey | BHMFVMPIDXJADY-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.70 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|