C12H15Cl4N3O — CID 119905192
2-[(3R)-3-aminopyrrolidin-1-yl]-N-(2,4,5-trichlorophenyl)acetamide;hydrochloride (PubChem CID 119905192) has the molecular formula C12H15Cl4N3O and a molecular weight of 359.08 g/mol. Its IUPAC name is 2-[(3R)-3-aminopyrrolidin-1-yl]-N-(2,4,5-trichlorophenyl)acetamide;hydrochloride.
| Compound Name | 2-[(3R)-3-aminopyrrolidin-1-yl]-N-(2,4,5-trichlorophenyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119905192 |
| Molecular Formula | C12H15Cl4N3O |
| Molecular Weight | 359.08 g/mol |
| Exact Mass | 357.00 |
| IUPAC Name | 2-[(3R)-3-aminopyrrolidin-1-yl]-N-(2,4,5-trichlorophenyl)acetamide;hydrochloride |
| SMILES | Cl.N[C@@H]1CCN(CC(=O)Nc2cc(Cl)c(Cl)cc2Cl)C1 |
| InChI | InChI=1S/C12H14Cl3N3O.ClH/c13-8-3-10(15)11(4-9(8)14)17-12(19)6-18-2-1-7(16)5-18;/h3-4,7H,1-2,5-6,16H2,(H,17,19);1H/t7-;/m1./s1 |
| InChIKey | BKMFCKYSZHZXGP-OGFXRTJISA-N |
| XLogP | 3.04 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.08 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|