C14H15Cl3N2O3 — CID 119907939
1-[2-oxo-2-(2,4,5-trichloroanilino)ethyl]piperidine-4-carboxylic acid (PubChem CID 119907939) has the molecular formula C14H15Cl3N2O3 and a molecular weight of 365.64 g/mol. Its IUPAC name is 1-[2-oxo-2-(2,4,5-trichloroanilino)ethyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[2-oxo-2-(2,4,5-trichloroanilino)ethyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 119907939 |
| Molecular Formula | C14H15Cl3N2O3 |
| Molecular Weight | 365.64 g/mol |
| Exact Mass | 364.01 |
| IUPAC Name | 1-[2-oxo-2-(2,4,5-trichloroanilino)ethyl]piperidine-4-carboxylic acid |
| SMILES | O=C(CN1CCC(C(=O)O)CC1)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C14H15Cl3N2O3/c15-9-5-11(17)12(6-10(9)16)18-13(20)7-19-3-1-8(2-4-19)14(21)22/h5-6,8H,1-4,7H2,(H,18,20)(H,21,22) |
| InChIKey | HTLOMHQDRNGOQW-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.64 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|