C18H25Cl3N4O3S — CID 16599044
2-[4-(azepan-1-ylsulfonyl)piperazin-1-yl]-N-(2,4,5-trichlorophenyl)acetamide (PubChem CID 16599044) has the molecular formula C18H25Cl3N4O3S and a molecular weight of 483.85 g/mol. Its IUPAC name is 2-[4-(azepan-1-ylsulfonyl)piperazin-1-yl]-N-(2,4,5-trichlorophenyl)acetamide.
| Compound Name | 2-[4-(azepan-1-ylsulfonyl)piperazin-1-yl]-N-(2,4,5-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 16599044 |
| Molecular Formula | C18H25Cl3N4O3S |
| Molecular Weight | 483.85 g/mol |
| Exact Mass | 482.07 |
| IUPAC Name | 2-[4-(azepan-1-ylsulfonyl)piperazin-1-yl]-N-(2,4,5-trichlorophenyl)acetamide |
| SMILES | O=C(CN1CCN(S(=O)(=O)N2CCCCCC2)CC1)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C18H25Cl3N4O3S/c19-14-11-16(21)17(12-15(14)20)22-18(26)13-23-7-9-25(10-8-23)29(27,28)24-5-3-1-2-4-6-24/h11-12H,1-10,13H2,(H,22,26) |
| InChIKey | BKMNBNLWFDHALU-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.85 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|