C16H22Cl2N4O4S — CID 6457048
N-(2,5-dichlorophenyl)-2-(4-morpholin-4-ylsulfonylpiperazin-1-yl)acetamide (PubChem CID 6457048) has the molecular formula C16H22Cl2N4O4S and a molecular weight of 437.35 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-2-(4-morpholin-4-ylsulfonylpiperazin-1-yl)acetamide.
| Compound Name | N-(2,5-dichlorophenyl)-2-(4-morpholin-4-ylsulfonylpiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 6457048 |
| Molecular Formula | C16H22Cl2N4O4S |
| Molecular Weight | 437.35 g/mol |
| Exact Mass | 436.07 |
| IUPAC Name | N-(2,5-dichlorophenyl)-2-(4-morpholin-4-ylsulfonylpiperazin-1-yl)acetamide |
| SMILES | O=C(CN1CCN(S(=O)(=O)N2CCOCC2)CC1)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C16H22Cl2N4O4S/c17-13-1-2-14(18)15(11-13)19-16(23)12-20-3-5-21(6-4-20)27(24,25)22-7-9-26-10-8-22/h1-2,11H,3-10,12H2,(H,19,23) |
| InChIKey | RTIFIYHPWDSAOI-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.35 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |