C21H24Cl2N4O2 — CID 29487883
N-benzyl-2-[4-[2-(2,5-dichloroanilino)-2-oxoethyl]piperazin-1-yl]acetamide (PubChem CID 29487883) has the molecular formula C21H24Cl2N4O2 and a molecular weight of 435.36 g/mol. Its IUPAC name is N-benzyl-2-[4-[2-(2,5-dichloroanilino)-2-oxoethyl]piperazin-1-yl]acetamide.
| Compound Name | N-benzyl-2-[4-[2-(2,5-dichloroanilino)-2-oxoethyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 29487883 |
| Molecular Formula | C21H24Cl2N4O2 |
| Molecular Weight | 435.36 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | N-benzyl-2-[4-[2-(2,5-dichloroanilino)-2-oxoethyl]piperazin-1-yl]acetamide |
| SMILES | O=C(CN1CCN(CC(=O)Nc2cc(Cl)ccc2Cl)CC1)NCc1ccccc1 |
| InChI | InChI=1S/C21H24Cl2N4O2/c22-17-6-7-18(23)19(12-17)25-21(29)15-27-10-8-26(9-11-27)14-20(28)24-13-16-4-2-1-3-5-16/h1-7,12H,8-11,13-15H2,(H,24,28)(H,25,29) |
| InChIKey | MMEUXWXVXYIBNI-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.36 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |