C20H23Cl2N3O2 — CID 9259761
N-(2,5-dichlorophenyl)-2-[4-(2-phenoxyethyl)piperazin-1-yl]acetamide (PubChem CID 9259761) has the molecular formula C20H23Cl2N3O2 and a molecular weight of 408.33 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-2-[4-(2-phenoxyethyl)piperazin-1-yl]acetamide.
| Compound Name | N-(2,5-dichlorophenyl)-2-[4-(2-phenoxyethyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 9259761 |
| Molecular Formula | C20H23Cl2N3O2 |
| Molecular Weight | 408.33 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | N-(2,5-dichlorophenyl)-2-[4-(2-phenoxyethyl)piperazin-1-yl]acetamide |
| SMILES | O=C(CN1CCN(CCOc2ccccc2)CC1)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C20H23Cl2N3O2/c21-16-6-7-18(22)19(14-16)23-20(26)15-25-10-8-24(9-11-25)12-13-27-17-4-2-1-3-5-17/h1-7,14H,8-13,15H2,(H,23,26) |
| InChIKey | HKDAAQBBYZATER-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.33 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |