C21H41N3O2 — CID 142596800
ethane;N-methyl-2-[4-(2-phenoxyethyl)piperazin-1-yl]acetamide (PubChem CID 142596800) has the molecular formula C21H41N3O2 and a molecular weight of 367.58 g/mol. Its IUPAC name is ethane;N-methyl-2-[4-(2-phenoxyethyl)piperazin-1-yl]acetamide.
| Compound Name | ethane;N-methyl-2-[4-(2-phenoxyethyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 142596800 |
| Molecular Formula | C21H41N3O2 |
| Molecular Weight | 367.58 g/mol |
| Exact Mass | 367.32 |
| IUPAC Name | ethane;N-methyl-2-[4-(2-phenoxyethyl)piperazin-1-yl]acetamide |
| SMILES | CC.CC.CC.CNC(=O)CN1CCN(CCOc2ccccc2)CC1 |
| InChI | InChI=1S/C15H23N3O2.3C2H6/c1-16-15(19)13-18-9-7-17(8-10-18)11-12-20-14-5-3-2-4-6-14;3*1-2/h2-6H,7-13H2,1H3,(H,16,19);3*1-2H3 |
| InChIKey | JQADPLDRUKJKHE-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.58 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |