C16H25N3O2 — CID 78792872
N,N-dimethyl-2-[4-(2-phenoxyethyl)piperazin-1-yl]acetamide (PubChem CID 78792872) has the molecular formula C16H25N3O2 and a molecular weight of 291.39 g/mol. Its IUPAC name is N,N-dimethyl-2-[4-(2-phenoxyethyl)piperazin-1-yl]acetamide.
| Compound Name | N,N-dimethyl-2-[4-(2-phenoxyethyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 78792872 |
| Molecular Formula | C16H25N3O2 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | N,N-dimethyl-2-[4-(2-phenoxyethyl)piperazin-1-yl]acetamide |
| SMILES | CN(C)C(=O)CN1CCN(CCOc2ccccc2)CC1 |
| InChI | InChI=1S/C16H25N3O2/c1-17(2)16(20)14-19-10-8-18(9-11-19)12-13-21-15-6-4-3-5-7-15/h3-7H,8-14H2,1-2H3 |
| InChIKey | MEFFHOHMOQGXMD-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |