C26H34ClN3O3 — CID 24995255
2-[4-[5-[4-(4-chlorobenzoyl)phenoxy]pentyl]piperazin-1-yl]-N,N-dimethylacetamide (PubChem CID 24995255) has the molecular formula C26H34ClN3O3 and a molecular weight of 472.03 g/mol. Its IUPAC name is 2-[4-[5-[4-(4-chlorobenzoyl)phenoxy]pentyl]piperazin-1-yl]-N,N-dimethylacetamide.
| Compound Name | 2-[4-[5-[4-(4-chlorobenzoyl)phenoxy]pentyl]piperazin-1-yl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 24995255 |
| Molecular Formula | C26H34ClN3O3 |
| Molecular Weight | 472.03 g/mol |
| Exact Mass | 471.23 |
| IUPAC Name | 2-[4-[5-[4-(4-chlorobenzoyl)phenoxy]pentyl]piperazin-1-yl]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CN1CCN(CCCCCOc2ccc(C(=O)c3ccc(Cl)cc3)cc2)CC1 |
| InChI | InChI=1S/C26H34ClN3O3/c1-28(2)25(31)20-30-17-15-29(16-18-30)14-4-3-5-19-33-24-12-8-22(9-13-24)26(32)21-6-10-23(27)11-7-21/h6-13H,3-5,14-20H2,1-2H3 |
| InChIKey | LTYHPDUSPLLWDL-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.03 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|