C26H33ClN4O3 — CID 25066896
2-[4-[5-[[3-(4-chlorophenyl)-1,2-benzoxazol-6-yl]oxy]pentyl]piperazin-1-yl]-N,N-dimethylacetamide (PubChem CID 25066896) has the molecular formula C26H33ClN4O3 and a molecular weight of 485.03 g/mol. Its IUPAC name is 2-[4-[5-[[3-(4-chlorophenyl)-1,2-benzoxazol-6-yl]oxy]pentyl]piperazin-1-yl]-N,N-dimethylacetamide.
| Compound Name | 2-[4-[5-[[3-(4-chlorophenyl)-1,2-benzoxazol-6-yl]oxy]pentyl]piperazin-1-yl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 25066896 |
| Molecular Formula | C26H33ClN4O3 |
| Molecular Weight | 485.03 g/mol |
| Exact Mass | 484.22 |
| IUPAC Name | 2-[4-[5-[[3-(4-chlorophenyl)-1,2-benzoxazol-6-yl]oxy]pentyl]piperazin-1-yl]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CN1CCN(CCCCCOc2ccc3c(-c4ccc(Cl)cc4)noc3c2)CC1 |
| InChI | InChI=1S/C26H33ClN4O3/c1-29(2)25(32)19-31-15-13-30(14-16-31)12-4-3-5-17-33-22-10-11-23-24(18-22)34-28-26(23)20-6-8-21(27)9-7-20/h6-11,18H,3-5,12-17,19H2,1-2H3 |
| InChIKey | WWDVTCOAGAMDBN-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 62.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.03 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|