C25H35ClN4O2 — CID 24996849
2-[4-[5-[4-(4-chloroanilino)phenoxy]pentyl]piperazin-1-yl]-N,N-dimethylacetamide (PubChem CID 24996849) has the molecular formula C25H35ClN4O2 and a molecular weight of 459.03 g/mol. Its IUPAC name is 2-[4-[5-[4-(4-chloroanilino)phenoxy]pentyl]piperazin-1-yl]-N,N-dimethylacetamide.
| Compound Name | 2-[4-[5-[4-(4-chloroanilino)phenoxy]pentyl]piperazin-1-yl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 24996849 |
| Molecular Formula | C25H35ClN4O2 |
| Molecular Weight | 459.03 g/mol |
| Exact Mass | 458.24 |
| IUPAC Name | 2-[4-[5-[4-(4-chloroanilino)phenoxy]pentyl]piperazin-1-yl]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CN1CCN(CCCCCOc2ccc(Nc3ccc(Cl)cc3)cc2)CC1 |
| InChI | InChI=1S/C25H35ClN4O2/c1-28(2)25(31)20-30-17-15-29(16-18-30)14-4-3-5-19-32-24-12-10-23(11-13-24)27-22-8-6-21(26)7-9-22/h6-13,27H,3-5,14-20H2,1-2H3 |
| InChIKey | MWYKAYLNHPZHNV-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.03 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|