C20H31N3O3 — CID 87732200
2-[4-[5-(4-formylphenoxy)pentyl]piperazin-1-yl]-N,N-dimethylacetamide (PubChem CID 87732200) has the molecular formula C20H31N3O3 and a molecular weight of 361.49 g/mol. Its IUPAC name is 2-[4-[5-(4-formylphenoxy)pentyl]piperazin-1-yl]-N,N-dimethylacetamide.
| Compound Name | 2-[4-[5-(4-formylphenoxy)pentyl]piperazin-1-yl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 87732200 |
| Molecular Formula | C20H31N3O3 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.24 |
| IUPAC Name | 2-[4-[5-(4-formylphenoxy)pentyl]piperazin-1-yl]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CN1CCN(CCCCCOc2ccc(C=O)cc2)CC1 |
| InChI | InChI=1S/C20H31N3O3/c1-21(2)20(25)16-23-13-11-22(12-14-23)10-4-3-5-15-26-19-8-6-18(17-24)7-9-19/h6-9,17H,3-5,10-16H2,1-2H3 |
| InChIKey | RRIDDQYELNOBPC-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|