C29H37ClN4O3 — CID 69190292
2-[4-[5-[1-acetyl-3-(4-chlorophenyl)indol-6-yl]oxypentyl]piperazin-1-yl]-N,N-dimethylacetamide (PubChem CID 69190292) has the molecular formula C29H37ClN4O3 and a molecular weight of 525.09 g/mol. Its IUPAC name is 2-[4-[5-[1-acetyl-3-(4-chlorophenyl)indol-6-yl]oxypentyl]piperazin-1-yl]-N,N-dimethylacetamide.
| Compound Name | 2-[4-[5-[1-acetyl-3-(4-chlorophenyl)indol-6-yl]oxypentyl]piperazin-1-yl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 69190292 |
| Molecular Formula | C29H37ClN4O3 |
| Molecular Weight | 525.09 g/mol |
| Exact Mass | 524.26 |
| IUPAC Name | 2-[4-[5-[1-acetyl-3-(4-chlorophenyl)indol-6-yl]oxypentyl]piperazin-1-yl]-N,N-dimethylacetamide |
| SMILES | CC(=O)n1cc(-c2ccc(Cl)cc2)c2ccc(OCCCCCN3CCN(CC(=O)N(C)C)CC3)cc21 |
| InChI | InChI=1S/C29H37ClN4O3/c1-22(35)34-20-27(23-7-9-24(30)10-8-23)26-12-11-25(19-28(26)34)37-18-6-4-5-13-32-14-16-33(17-15-32)21-29(36)31(2)3/h7-12,19-20H,4-6,13-18,21H2,1-3H3 |
| InChIKey | FQQFHZLRHBQUJB-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 58.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.09 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|