C26H34ClN5O2 — CID 69170073
2-[2-[4-[5-[[3-(4-chlorophenyl)-1-benzofuran-6-yl]oxy]pentyl]piperazin-1-yl]ethyl]guanidine (PubChem CID 69170073) has the molecular formula C26H34ClN5O2 and a molecular weight of 484.04 g/mol. Its IUPAC name is 2-[2-[4-[5-[[3-(4-chlorophenyl)-1-benzofuran-6-yl]oxy]pentyl]piperazin-1-yl]ethyl]guanidine.
| Compound Name | 2-[2-[4-[5-[[3-(4-chlorophenyl)-1-benzofuran-6-yl]oxy]pentyl]piperazin-1-yl]ethyl]guanidine |
|---|---|
| PubChem CID | 69170073 |
| Molecular Formula | C26H34ClN5O2 |
| Molecular Weight | 484.04 g/mol |
| Exact Mass | 483.24 |
| IUPAC Name | 2-[2-[4-[5-[[3-(4-chlorophenyl)-1-benzofuran-6-yl]oxy]pentyl]piperazin-1-yl]ethyl]guanidine |
| SMILES | NC(N)=NCCN1CCN(CCCCCOc2ccc3c(-c4ccc(Cl)cc4)coc3c2)CC1 |
| InChI | InChI=1S/C26H34ClN5O2/c27-21-6-4-20(5-7-21)24-19-34-25-18-22(8-9-23(24)25)33-17-3-1-2-11-31-13-15-32(16-14-31)12-10-30-26(28)29/h4-9,18-19H,1-3,10-17H2,(H4,28,29,30) |
| InChIKey | NVOMWKADJVNXTJ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 93.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.04 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|