C27H33NO4 — CID 56640468
7-[5-(4-ethylpiperidin-1-yl)pentoxy]-3-(4-hydroxyphenyl)chromen-4-one (PubChem CID 56640468) has the molecular formula C27H33NO4 and a molecular weight of 435.56 g/mol. Its IUPAC name is 7-[5-(4-ethylpiperidin-1-yl)pentoxy]-3-(4-hydroxyphenyl)chromen-4-one.
| Compound Name | 7-[5-(4-ethylpiperidin-1-yl)pentoxy]-3-(4-hydroxyphenyl)chromen-4-one |
|---|---|
| PubChem CID | 56640468 |
| Molecular Formula | C27H33NO4 |
| Molecular Weight | 435.56 g/mol |
| Exact Mass | 435.24 |
| IUPAC Name | 7-[5-(4-ethylpiperidin-1-yl)pentoxy]-3-(4-hydroxyphenyl)chromen-4-one |
| SMILES | CCC1CCN(CCCCCOc2ccc3c(=O)c(-c4ccc(O)cc4)coc3c2)CC1 |
| InChI | InChI=1S/C27H33NO4/c1-2-20-12-15-28(16-13-20)14-4-3-5-17-31-23-10-11-24-26(18-23)32-19-25(27(24)30)21-6-8-22(29)9-7-21/h6-11,18-20,29H,2-5,12-17H2,1H3 |
| InChIKey | BBOKOZDGUCQFSU-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 62.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.56 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|