C30H32N2O4 — CID 54759747
3-[4-[4-(4-benzylpiperazin-1-yl)butoxy]phenyl]-7-hydroxychromen-4-one (PubChem CID 54759747) has the molecular formula C30H32N2O4 and a molecular weight of 484.60 g/mol. Its IUPAC name is 3-[4-[4-(4-benzylpiperazin-1-yl)butoxy]phenyl]-7-hydroxychromen-4-one.
| Compound Name | 3-[4-[4-(4-benzylpiperazin-1-yl)butoxy]phenyl]-7-hydroxychromen-4-one |
|---|---|
| PubChem CID | 54759747 |
| Molecular Formula | C30H32N2O4 |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.24 |
| IUPAC Name | 3-[4-[4-(4-benzylpiperazin-1-yl)butoxy]phenyl]-7-hydroxychromen-4-one |
| SMILES | O=c1c(-c2ccc(OCCCCN3CCN(Cc4ccccc4)CC3)cc2)coc2cc(O)ccc12 |
| InChI | InChI=1S/C30H32N2O4/c33-25-10-13-27-29(20-25)36-22-28(30(27)34)24-8-11-26(12-9-24)35-19-5-4-14-31-15-17-32(18-16-31)21-23-6-2-1-3-7-23/h1-3,6-13,20,22,33H,4-5,14-19,21H2 |
| InChIKey | WBFPJNYYUNUYCQ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|