C27H24N2O6 — CID 71664471
[4-(5,7-dihydroxy-4-oxochromen-3-yl)phenyl] 4-benzylpiperazine-1-carboxylate (PubChem CID 71664471) has the molecular formula C27H24N2O6 and a molecular weight of 472.50 g/mol. Its IUPAC name is [4-(5,7-dihydroxy-4-oxochromen-3-yl)phenyl] 4-benzylpiperazine-1-carboxylate.
| Compound Name | [4-(5,7-dihydroxy-4-oxochromen-3-yl)phenyl] 4-benzylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 71664471 |
| Molecular Formula | C27H24N2O6 |
| Molecular Weight | 472.50 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | [4-(5,7-dihydroxy-4-oxochromen-3-yl)phenyl] 4-benzylpiperazine-1-carboxylate |
| SMILES | O=C(Oc1ccc(-c2coc3cc(O)cc(O)c3c2=O)cc1)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C27H24N2O6/c30-20-14-23(31)25-24(15-20)34-17-22(26(25)32)19-6-8-21(9-7-19)35-27(33)29-12-10-28(11-13-29)16-18-4-2-1-3-5-18/h1-9,14-15,17,30-31H,10-13,16H2 |
| InChIKey | GQOALCRULDRWOC-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 103.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.50 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |