C20H18O5 — CID 12017762
(5-hydroxy-4-oxo-3-phenylchromen-7-yl) 2,2-dimethylpropanoate (PubChem CID 12017762) has the molecular formula C20H18O5 and a molecular weight of 338.36 g/mol. Its IUPAC name is (5-hydroxy-4-oxo-3-phenylchromen-7-yl) 2,2-dimethylpropanoate.
| Compound Name | (5-hydroxy-4-oxo-3-phenylchromen-7-yl) 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 12017762 |
| Molecular Formula | C20H18O5 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | (5-hydroxy-4-oxo-3-phenylchromen-7-yl) 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)Oc1cc(O)c2c(=O)c(-c3ccccc3)coc2c1 |
| InChI | InChI=1S/C20H18O5/c1-20(2,3)19(23)25-13-9-15(21)17-16(10-13)24-11-14(18(17)22)12-7-5-4-6-8-12/h4-11,21H,1-3H3 |
| InChIKey | YWABDXBMWCXDNY-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|