C15H10MgO5 — CID 66722646
CID 66722646 (PubChem CID 66722646) has the molecular formula C15H10MgO5 and a molecular weight of 294.55 g/mol.
| Compound Name | CID 66722646 |
|---|---|
| PubChem CID | 66722646 |
| Molecular Formula | C15H10MgO5 |
| Molecular Weight | 294.55 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | — |
| SMILES | O=c1c(-c2ccc(O)cc2)coc2cc(O)cc(O)c12.[Mg] |
| InChI | InChI=1S/C15H10O5.Mg/c16-9-3-1-8(2-4-9)11-7-20-13-6-10(17)5-12(18)14(13)15(11)19;/h1-7,16-18H; |
| InChIKey | ULQZJDBYAPKCMU-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.55 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |